Phenylsulfanyltetrafluoroethanesulfonyl fluoride
| Cat. # | Quantity | Price | Lead time | Buy this product |
|---|---|---|---|---|
| SF001_0250 | 0.25 g | 450,00 € | in stock | |
| SF001_0500 | 0.5 g | 700,00 € | in stock | |
| SF001_1 | 1 g | 1.200,00 € | in stock | |
| SF001_5 | 5 g | 3.990,00 € | in stock |
- IUPAC Name: 1,1,2,2-Tetrafluoro-2-(phenylthio)ethane-1-sulfonyl fluoride
- Synonyms: PhSCF2CF2SO2F, Phenylsulphanyltetrafluoroethanesulphonyl fluoride
- CAS: 1000294-01-8
- Smiles: FC(F)(C(F)(S(=O)(F)=O)F)SC1=CC=CC=C1
- Chemical formula: C8H5F5O2S2
- Molecular weight: 292.245
- Purity: 95%+
Phenylsulfanyltetrafluoroethanesulfonyl fluoride serves as a moderately reactive phenylsulfanyltetrafluoroethanesulfonylation reagent. A phenylsulfanyltetrafluoroethyl moiety incorporated in the substrate can be treated with tributyltin hydride and generate the corresponding fluoroalkyl radical. If the substrate lacks any olefine, it can be reduced to tetrafluoroethyl group. Fluoroalkylsulfonylation of the amine nitrogen greatly lowers the pKa value of NH and can be used to modulate the behaviour of the drug candidate or build additional molecular complexity around the highly acidic fluoroalkylsulfonamide nitrogen.