Di-(N-succinimidyl) pimelate
| Cat. # | Quantity | Price | Lead time | Buy this product |
|---|---|---|---|---|
| PCL009_1 | 1 g | 85,00 € | in stock | |
| PCL009_5 | 5 g | 340,00 € | in stock | |
| PCL009_10 | 10 g | 600,00 € | in stock | |
| PCL009_50 | 50 g | 2.200,00 € | in stock |
- IUPAC Name: Bis(2,5-dioxopyrrolidin-1-yl) heptanedioate
- Synonyms: Disuccinimidyl pimelate, Disuccinimidyl heptanedioate, Di(N-succinimidyl) pimelate, Bis(2,5-dioxopyrrolidin-1-yl) pimelate
- CAS: 74648-14-9
- Smiles: O=C(CCC1=O)N1OC(CCCCCC(ON2C(CCC2=O)=O)=O)=O
- Chemical formula: C15H18N2O8
- Molecular weight: 354.31
- Purity: 98%+
Di-(N-succinimidyl) pimelate is an amine-reactive homobifunctional cross-linker. At neutral or slightly basic pH (7-9), it rapidly attacks solvent accessible lysine-NH2 groups and N-termini. While generally less often used than DSG, DSS and DSSeb, protein structure analysis based on chemical crosslinking with disuccinimidyl pimelate can generate additional structural information.